C10H8O — CID 71356014
1aH-naphtho[1,8a-b]oxirene (PubChem CID 71356014) has the molecular formula C10H8O and a molecular weight of 144.17 g/mol. Its IUPAC name is 1aH-naphtho[1,8a-b]oxirene.
| Compound Name | 1aH-naphtho[1,8a-b]oxirene |
|---|---|
| PubChem CID | 71356014 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 1aH-naphtho[1,8a-b]oxirene |
| SMILES | C1=CC2=CC=CC3OC23C=C1 |
| InChI | InChI=1S/C10H8O/c1-2-7-10-8(4-1)5-3-6-9(10)11-10/h1-7,9H |
| InChIKey | YAAQQUGKYWUEPL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|