About 1H-benzo[j]naphthalene
1H-benzo[j]naphthalene (PubChem CID 122204342) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1H-benzo[j]naphthalene.
Molecular Properties
| Compound Name | 1H-benzo[j]naphthalene |
| PubChem CID | 122204342 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1H-benzo[j]naphthalene |
| SMILES | C1=CCC23C=CC=CC2=CC=CC3=C1 |
| InChI | InChI=1S/C14H12/c1-3-10-14-11-4-2-7-13(14)9-5-8-12(14)6-1/h1-10H,11H2 |
| InChIKey | XSAUGYQCWBMDOX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-benzo[j]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[j]naphthalene?
The IUPAC name of 1H-benzo[j]naphthalene (CID 122204342) is 1H-benzo[j]naphthalene.
What is the SMILES notation for 1H-benzo[j]naphthalene?
The canonical SMILES for 1H-benzo[j]naphthalene is C1=CCC23C=CC=CC2=CC=CC3=C1.
What is the InChIKey of 1H-benzo[j]naphthalene?
The InChIKey is XSAUGYQCWBMDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-3-10-14-11-4-2-7-13(14)9-5-8-12(14)6-1/h1-10H,11H2.
What are the key properties of 1H-benzo[j]naphthalene?
1H-benzo[j]naphthalene has a molecular weight of 180.25 g/mol, XLogP of 3.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[j]naphthalene is sourced from PubChem (CID 122204342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).