About 1H-benzo[i]quinoline
1H-benzo[i]quinoline (PubChem CID 131983586) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1H-benzo[i]quinoline.
Molecular Properties
| Compound Name | 1H-benzo[i]quinoline |
| PubChem CID | 131983586 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1H-benzo[i]quinoline |
| SMILES | C1=CNC23C=CC=CC2=CC=CC3=C1 |
| InChI | InChI=1S/C13H11N/c1-2-9-13-11(5-1)6-3-7-12(13)8-4-10-14-13/h1-10,14H |
| InChIKey | BJICZKZKKDUALH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzo[i]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[i]quinoline?
The IUPAC name of 1H-benzo[i]quinoline (CID 131983586) is 1H-benzo[i]quinoline.
What is the SMILES notation for 1H-benzo[i]quinoline?
The canonical SMILES for 1H-benzo[i]quinoline is C1=CNC23C=CC=CC2=CC=CC3=C1.
What is the InChIKey of 1H-benzo[i]quinoline?
The InChIKey is BJICZKZKKDUALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-9-13-11(5-1)6-3-7-12(13)8-4-10-14-13/h1-10,14H.
What are the key properties of 1H-benzo[i]quinoline?
1H-benzo[i]quinoline has a molecular weight of 181.24 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[i]quinoline is sourced from PubChem (CID 131983586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).