C9H15N — CID 23162595
2-ethyl-2,5-dimethyl-1H-pyridine (PubChem CID 23162595) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 2-ethyl-2,5-dimethyl-1H-pyridine.
| Compound Name | 2-ethyl-2,5-dimethyl-1H-pyridine |
|---|---|
| PubChem CID | 23162595 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2-ethyl-2,5-dimethyl-1H-pyridine |
| SMILES | CCC1(C)C=CC(C)=CN1 |
| InChI | InChI=1S/C9H15N/c1-4-9(3)6-5-8(2)7-10-9/h5-7,10H,4H2,1-3H3 |
| InChIKey | WPEWYQPFYPVYPT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |