C16H16 — CID 141425966
tetracyclo[7.6.1.01,6.013,16]hexadeca-2,4,6,8,13(16)-pentaene (PubChem CID 141425966) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is tetracyclo[7.6.1.01,6.013,16]hexadeca-2,4,6,8,13(16)-pentaene.
| Compound Name | tetracyclo[7.6.1.01,6.013,16]hexadeca-2,4,6,8,13(16)-pentaene |
|---|---|
| PubChem CID | 141425966 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | tetracyclo[7.6.1.01,6.013,16]hexadeca-2,4,6,8,13(16)-pentaene |
| SMILES | C1=CC2=CC=C3CCCC4=C3C2(C=C1)CC4 |
| InChI | InChI=1S/C16H16/c1-2-10-16-11-9-13-5-3-4-12(15(13)16)7-8-14(16)6-1/h1-2,6-8,10H,3-5,9,11H2 |
| InChIKey | GAOMTDRLKLGDNS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |