C9H10O2 — CID 171617078
2-oxatricyclo[5.3.0.01,3]deca-4,6-dien-8-ol (PubChem CID 171617078) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-oxatricyclo[5.3.0.01,3]deca-4,6-dien-8-ol.
| Compound Name | 2-oxatricyclo[5.3.0.01,3]deca-4,6-dien-8-ol |
|---|---|
| PubChem CID | 171617078 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-oxatricyclo[5.3.0.01,3]deca-4,6-dien-8-ol |
| SMILES | OC1CCC23OC2C=CC=C13 |
| InChI | InChI=1S/C9H10O2/c10-7-4-5-9-6(7)2-1-3-8(9)11-9/h1-3,7-8,10H,4-5H2 |
| InChIKey | KCFGOSIXFIQFAR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|