C12H10O — CID 71405158
3-oxatetracyclo[7.2.2.02,4.02,8]trideca-1(11),5,7,9-tetraene (PubChem CID 71405158) has the molecular formula C12H10O and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-oxatetracyclo[7.2.2.02,4.02,8]trideca-1(11),5,7,9-tetraene.
| Compound Name | 3-oxatetracyclo[7.2.2.02,4.02,8]trideca-1(11),5,7,9-tetraene |
|---|---|
| PubChem CID | 71405158 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-oxatetracyclo[7.2.2.02,4.02,8]trideca-1(11),5,7,9-tetraene |
| SMILES | C1=CC2OC23C2=CC=C(CC2)C3=C1 |
| InChI | InChI=1S/C12H10O/c1-2-10-8-4-6-9(7-5-8)12(10)11(3-1)13-12/h1-4,6,11H,5,7H2 |
| InChIKey | FWNGWIOTUMQKLW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|