About 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid
2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid (PubChem CID 163558508) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid.
Analyze 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid?
The IUPAC name of 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid (CID 163558508) is 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid.
What is the SMILES notation for 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid?
The canonical SMILES for 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid is CC1(C)CCC2=CC=CC(C(=O)O)C2O1.
What is the InChIKey of 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid?
The InChIKey is FPETXYJOFNPWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-12(2)7-6-8-4-3-5-9(11(13)14)10(8)15-12/h3-5,9-10H,6-7H2,1-2H3,(H,13,14).
What are the key properties of 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid?
2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid has a molecular weight of 208.26 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3,4,8,8a-tetrahydrochromene-8-carboxylic acid is sourced from PubChem (CID 163558508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).