C15H20O4 — CID 132838455
(1R,2S,5R,8R,11R)-7-(hydroxymethyl)-15-oxatetracyclo[6.6.1.01,10.02,6]pentadeca-6,9-diene-5,11-diol (PubChem CID 132838455) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,2S,5R,8R,11R)-7-(hydroxymethyl)-15-oxatetracyclo[6.6.1.01,10.02,6]pentadeca-6,9-diene-5,11-diol.
| Compound Name | (1R,2S,5R,8R,11R)-7-(hydroxymethyl)-15-oxatetracyclo[6.6.1.01,10.02,6]pentadeca-6,9-diene-5,11-diol |
|---|---|
| PubChem CID | 132838455 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,2S,5R,8R,11R)-7-(hydroxymethyl)-15-oxatetracyclo[6.6.1.01,10.02,6]pentadeca-6,9-diene-5,11-diol |
| SMILES | OCC1=C2[C@H](O)CC[C@@H]2[C@]23CCC[C@@H](O)C2=C[C@H]1O3 |
| InChI | InChI=1S/C15H20O4/c16-7-8-13-6-10-11(17)2-1-5-15(10,19-13)9-3-4-12(18)14(8)9/h6,9,11-13,16-18H,1-5,7H2/t9-,11+,12+,13+,15+/m0/s1 |
| InChIKey | YCLNNPOKODVLOJ-QUQNROOTSA-N |
| XLogP | 0.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|