C11H16O2 — CID 130145147
5-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one (PubChem CID 130145147) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one.
| Compound Name | 5-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 130145147 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 5-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one |
| SMILES | CC12CCCC(O)C1=CCCC2=O |
| InChI | InChI=1S/C11H16O2/c1-11-7-3-5-9(12)8(11)4-2-6-10(11)13/h4,9,12H,2-3,5-7H2,1H3 |
| InChIKey | LAOQDOVJPVABPV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|