C18H30O2 — CID 90870442
1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-4,5,6,7-tetrahydro-2H-inden-4-ol (PubChem CID 90870442) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-4,5,6,7-tetrahydro-2H-inden-4-ol.
| Compound Name | 1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-4,5,6,7-tetrahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 90870442 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-4,5,6,7-tetrahydro-2H-inden-4-ol |
| SMILES | CC(CCCC(C)(C)O)=C1CC=C2C(O)CCCC21C |
| InChI | InChI=1S/C18H30O2/c1-13(7-5-11-17(2,3)20)14-9-10-15-16(19)8-6-12-18(14,15)4/h10,16,19-20H,5-9,11-12H2,1-4H3 |
| InChIKey | GSENFGXSJMZFIJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|