C28H46O3 — CID 89075776
(E,2R,4R,8E)-8-[(1E,7aS)-1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]-6-methyl-3-methylideneoct-6-ene-2,4-diol (PubChem CID 89075776) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (E,2R,4R,8E)-8-[(1E,7aS)-1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]-6-methyl-3-methylideneoct-6-ene-2,4-diol.
| Compound Name | (E,2R,4R,8E)-8-[(1E,7aS)-1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]-6-methyl-3-methylideneoct-6-ene-2,4-diol |
|---|---|
| PubChem CID | 89075776 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (E,2R,4R,8E)-8-[(1E,7aS)-1-(6-hydroxy-6-methylheptan-2-ylidene)-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]-6-methyl-3-methylideneoct-6-ene-2,4-diol |
| SMILES | C=C([C@H](O)C/C(C)=C/C=C1\CCC[C@]2(C)/C(=C(\C)CCCC(C)(C)O)CCC12)[C@@H](C)O |
| InChI | InChI=1S/C28H46O3/c1-19(18-26(30)21(3)22(4)29)12-13-23-11-9-17-28(7)24(14-15-25(23)28)20(2)10-8-16-27(5,6)31/h12-13,22,25-26,29-31H,3,8-11,14-18H2,1-2,4-7H3/b19-12+,23-13+,24-20+/t22-,25?,26-,28-/m1/s1 |
| InChIKey | INPVDAISGVFEGB-PHZDSMQXSA-N |
| XLogP | 6.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|