C25H39NO3 — CID 56636361
(1S)-3-[2-[(3aS,7aS)-1-[1-[(2-hydroxy-2-methylpropoxy)amino]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 56636361) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is (1S)-3-[2-[(3aS,7aS)-1-[1-[(2-hydroxy-2-methylpropoxy)amino]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S)-3-[2-[(3aS,7aS)-1-[1-[(2-hydroxy-2-methylpropoxy)amino]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 56636361 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (1S)-3-[2-[(3aS,7aS)-1-[1-[(2-hydroxy-2-methylpropoxy)amino]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)CC1=CC=C1CCC[C@]2(C)C(=C(C)NOCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C25H39NO3/c1-17-8-11-21(27)15-20(17)10-9-19-7-6-14-25(5)22(12-13-23(19)25)18(2)26-29-16-24(3,4)28/h9-10,21,23,26-28H,1,6-8,11-16H2,2-5H3/t21-,23-,25+/m0/s1 |
| InChIKey | GXFDINNKJDMFNH-UMXIMWEHSA-N |
| XLogP | 5.11 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|