C21H29NO4 — CID 140783670
2-[(E)-[(4E,7aS)-4-[(2Z)-2-[(5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ylidene]amino]oxyacetic acid (PubChem CID 140783670) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(E)-[(4E,7aS)-4-[(2Z)-2-[(5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[(4E,7aS)-4-[(2Z)-2-[(5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 140783670 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[(E)-[(4E,7aS)-4-[(2Z)-2-[(5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ylidene]amino]oxyacetic acid |
| SMILES | C=C1CC[C@@H](O)C/C1=C/C=C1\CCC[C@]2(C)/C(=N/OCC(=O)O)CCC12 |
| InChI | InChI=1S/C21H29NO4/c1-14-5-8-17(23)12-16(14)7-6-15-4-3-11-21(2)18(15)9-10-19(21)22-26-13-20(24)25/h6-7,17-18,23H,1,3-5,8-13H2,2H3,(H,24,25)/b15-6+,16-7-,22-19+/t17-,18?,21+/m1/s1 |
| InChIKey | PFOXSVZLKXOVDL-HFJAYPKDSA-N |
| XLogP | 4.00 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|