C19H30 — CID 143086886
(3aS,7E)-3,3a-dimethyl-7-[(Z)-3-methylhept-2-enylidene]-4,5,6,7a-tetrahydro-1H-indene (PubChem CID 143086886) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is (3aS,7E)-3,3a-dimethyl-7-[(Z)-3-methylhept-2-enylidene]-4,5,6,7a-tetrahydro-1H-indene.
| Compound Name | (3aS,7E)-3,3a-dimethyl-7-[(Z)-3-methylhept-2-enylidene]-4,5,6,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 143086886 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (3aS,7E)-3,3a-dimethyl-7-[(Z)-3-methylhept-2-enylidene]-4,5,6,7a-tetrahydro-1H-indene |
| SMILES | CCCC/C(C)=C\C=C1/CCC[C@]2(C)C(C)=CCC12 |
| InChI | InChI=1S/C19H30/c1-5-6-8-15(2)10-12-17-9-7-14-19(4)16(3)11-13-18(17)19/h10-12,18H,5-9,13-14H2,1-4H3/b15-10-,17-12+/t18?,19-/m1/s1 |
| InChIKey | GCKSYVWGTNSQJZ-UUYIUIOLSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|