C13H19BrO — CID 91344064
(1S)-1-[(7aS)-4-(bromomethylidene)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethanol (PubChem CID 91344064) has the molecular formula C13H19BrO and a molecular weight of 271.20 g/mol. Its IUPAC name is (1S)-1-[(7aS)-4-(bromomethylidene)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethanol.
| Compound Name | (1S)-1-[(7aS)-4-(bromomethylidene)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethanol |
|---|---|
| PubChem CID | 91344064 |
| Molecular Formula | C13H19BrO |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (1S)-1-[(7aS)-4-(bromomethylidene)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethanol |
| SMILES | C[C@H](O)C1=CCC2C(=CBr)CCC[C@]12C |
| InChI | InChI=1S/C13H19BrO/c1-9(15)11-5-6-12-10(8-14)4-3-7-13(11,12)2/h5,8-9,12,15H,3-4,6-7H2,1-2H3/t9-,12?,13+/m0/s1 |
| InChIKey | CKTYDDPRYDOZGS-OBBQPFKBSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|