C13H19Br — CID 59456521
(3E,3aS,7E,7aR)-7-(bromomethylidene)-3-ethylidene-3a-methyl-1,2,4,5,6,7a-hexahydroindene (PubChem CID 59456521) has the molecular formula C13H19Br and a molecular weight of 255.20 g/mol. Its IUPAC name is (3E,3aS,7E,7aR)-7-(bromomethylidene)-3-ethylidene-3a-methyl-1,2,4,5,6,7a-hexahydroindene.
| Compound Name | (3E,3aS,7E,7aR)-7-(bromomethylidene)-3-ethylidene-3a-methyl-1,2,4,5,6,7a-hexahydroindene |
|---|---|
| PubChem CID | 59456521 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3E,3aS,7E,7aR)-7-(bromomethylidene)-3-ethylidene-3a-methyl-1,2,4,5,6,7a-hexahydroindene |
| SMILES | C/C=C1\CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C13H19Br/c1-3-11-6-7-12-10(9-14)5-4-8-13(11,12)2/h3,9,12H,4-8H2,1-2H3/b10-9+,11-3+/t12-,13+/m0/s1 |
| InChIKey | IHOCICUGLIPCHX-HFYVLVIESA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|