C13H21BrO — CID 143477680
(1R,4E,7aS)-4-(bromomethylidene)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ol (PubChem CID 143477680) has the molecular formula C13H21BrO and a molecular weight of 273.21 g/mol. Its IUPAC name is (1R,4E,7aS)-4-(bromomethylidene)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ol.
| Compound Name | (1R,4E,7aS)-4-(bromomethylidene)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 143477680 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (1R,4E,7aS)-4-(bromomethylidene)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydroinden-1-ol |
| SMILES | CC[C@@]1(O)CCC2/C(=C/Br)CCC[C@@]21C |
| InChI | InChI=1S/C13H21BrO/c1-3-13(15)8-6-11-10(9-14)5-4-7-12(11,13)2/h9,11,15H,3-8H2,1-2H3/b10-9+/t11?,12-,13+/m0/s1 |
| InChIKey | UISBLEVFFRUBQH-SWUMAXRHSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |