C20H31BrF3NO — CID 169320148
1-[(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-(trifluoromethyl)piperidin-3-ol (PubChem CID 169320148) has the molecular formula C20H31BrF3NO and a molecular weight of 438.37 g/mol. Its IUPAC name is 1-[(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-(trifluoromethyl)piperidin-3-ol.
| Compound Name | 1-[(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-(trifluoromethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 169320148 |
| Molecular Formula | C20H31BrF3NO |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 1-[(2S)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-(trifluoromethyl)piperidin-3-ol |
| SMILES | C[C@H](CN1CCCC(O)(C(F)(F)F)C1)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C20H31BrF3NO/c1-14(12-25-10-4-9-19(26,13-25)20(22,23)24)16-6-7-17-15(11-21)5-3-8-18(16,17)2/h11,14,16-17,26H,3-10,12-13H2,1-2H3/b15-11+/t14-,16-,17+,18-,19?/m1/s1 |
| InChIKey | JYBUNKBLTCQCPQ-CHVIDLGNSA-N |
| XLogP | 5.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |