C20H24O — CID 59958329
(13S,17Z)-17-ethylidene-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 59958329) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (13S,17Z)-17-ethylidene-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (13S,17Z)-17-ethylidene-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59958329 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (13S,17Z)-17-ethylidene-13-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C=C1/CCC2C3=CCc4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C20H24O/c1-3-14-5-9-19-18-7-4-13-12-15(21)6-8-16(13)17(18)10-11-20(14,19)2/h3,6-8,12,17,19,21H,4-5,9-11H2,1-2H3/b14-3-/t17?,19?,20-/m1/s1 |
| InChIKey | TVYRZFXVFKIAKY-WYEDJUNASA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|