C20H26O2 — CID 59958339
(6R,13S,17Z)-17-ethylidene-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol (PubChem CID 59958339) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (6R,13S,17Z)-17-ethylidene-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol.
| Compound Name | (6R,13S,17Z)-17-ethylidene-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 59958339 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (6R,13S,17Z)-17-ethylidene-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol |
| SMILES | C/C=C1/CCC2C3C[C@@H](O)c4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C20H26O2/c1-3-12-4-7-18-16-11-19(22)17-10-13(21)5-6-14(17)15(16)8-9-20(12,18)2/h3,5-6,10,15-16,18-19,21-22H,4,7-9,11H2,1-2H3/b12-3-/t15?,16?,18?,19-,20-/m1/s1 |
| InChIKey | XPUMFDQASBQWRB-XIYXTWTLSA-N |
| XLogP | 4.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|