C18H22O6S — CID 102187598
[(6S,8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate (PubChem CID 102187598) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is [(6S,8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate.
| Compound Name | [(6S,8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 102187598 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [(6S,8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4[C@@H](OS(=O)(=O)O)C[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H22O6S/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(24-25(21,22)23)9-13(12)15(18)4-5-17(18)20/h2-3,8,12-13,15-16,19H,4-7,9H2,1H3,(H,21,22,23)/t12-,13-,15+,16+,18+/m1/s1 |
| InChIKey | WHPRFHQMBCXYMD-WUAUYOTNSA-N |
| XLogP | 3.14 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|