C19H22F2O2 — CID 67651121
(6S,8S,9S,13S,14S)-17-(difluoromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol (PubChem CID 67651121) has the molecular formula C19H22F2O2 and a molecular weight of 320.38 g/mol. Its IUPAC name is (6S,8S,9S,13S,14S)-17-(difluoromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol.
| Compound Name | (6S,8S,9S,13S,14S)-17-(difluoromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 67651121 |
| Molecular Formula | C19H22F2O2 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (6S,8S,9S,13S,14S)-17-(difluoromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,6-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4[C@@H](O)C[C@H]3[C@@H]1CCC2=C(F)F |
| InChI | InChI=1S/C19H22F2O2/c1-19-7-6-12-11-3-2-10(22)8-14(11)17(23)9-13(12)15(19)4-5-16(19)18(20)21/h2-3,8,12-13,15,17,22-23H,4-7,9H2,1H3/t12-,13-,15+,17+,19+/m1/s1 |
| InChIKey | MMSYZDBRHHSGFP-PYEWSWHRSA-N |
| XLogP | 4.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |