C18H20O — CID 22950899
17-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 22950899) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 17-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 22950899 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 17-methyl-9,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C2CCC3C(=CCc4cc(O)ccc43)C2CC1 |
| InChI | InChI=1S/C18H20O/c1-11-2-5-16-14(11)8-9-17-15-7-4-13(19)10-12(15)3-6-18(16)17/h4,6-7,10,16-17,19H,2-3,5,8-9H2,1H3 |
| InChIKey | SUOAFOZFGIRRCR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|