C14H22 — CID 143295241
(3aS)-3a-methyl-7-methylidene-3-propyl-4,5,6,7a-tetrahydro-1H-indene (PubChem CID 143295241) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3aS)-3a-methyl-7-methylidene-3-propyl-4,5,6,7a-tetrahydro-1H-indene.
| Compound Name | (3aS)-3a-methyl-7-methylidene-3-propyl-4,5,6,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 143295241 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3aS)-3a-methyl-7-methylidene-3-propyl-4,5,6,7a-tetrahydro-1H-indene |
| SMILES | C=C1CCC[C@]2(C)C(CCC)=CCC12 |
| InChI | InChI=1S/C14H22/c1-4-6-12-8-9-13-11(2)7-5-10-14(12,13)3/h8,13H,2,4-7,9-10H2,1,3H3/t13?,14-/m1/s1 |
| InChIKey | FWFHSWWPZJEEBA-ARLHGKGLSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|