C26H38O3S — CID 91114191
1-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-3-methylbutane-2-thione (PubChem CID 91114191) has the molecular formula C26H38O3S and a molecular weight of 430.65 g/mol. Its IUPAC name is 1-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-3-methylbutane-2-thione.
| Compound Name | 1-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-3-methylbutane-2-thione |
|---|---|
| PubChem CID | 91114191 |
| Molecular Formula | C26H38O3S |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-3-methylbutane-2-thione |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(OCC(=S)C(C)C)CC1O |
| InChI | InChI=1S/C26H38O3S/c1-6-21-11-12-22-19(8-7-13-25(21,22)5)9-10-20-14-26(28,15-23(27)18(20)4)29-16-24(30)17(2)3/h9-11,17,22-23,27-28H,4,6-8,12-16H2,1-3,5H3/t22-,23?,25+,26-/m0/s1 |
| InChIKey | OAZYZKVQPXGCJX-FBBPCMQYSA-N |
| XLogP | 5.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|