C27H41NO4 — CID 91001915
2-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-methyl-N-propan-2-ylacetamide (PubChem CID 91001915) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 2-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 91001915 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-methyl-N-propan-2-ylacetamide |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CCC23)CC(O)(OCC(=O)N(C)C(C)C)C[C@@H]1O |
| InChI | InChI=1S/C27H41NO4/c1-7-22-12-13-23-20(9-8-14-26(22,23)5)10-11-21-15-27(31,16-24(29)19(21)4)32-17-25(30)28(6)18(2)3/h10-12,18,23-24,29,31H,4,7-9,13-17H2,1-3,5-6H3/t23?,24-,26+,27?/m0/s1 |
| InChIKey | AVZJZGCGDVQPAE-ZRKUTJMGSA-N |
| XLogP | 4.67 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|