C26H41NO4 — CID 91518277
3-[(1S,5S)-3-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N,N-dimethylpropanamide (PubChem CID 91518277) has the molecular formula C26H41NO4 and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-[(1S,5S)-3-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N,N-dimethylpropanamide.
| Compound Name | 3-[(1S,5S)-3-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 91518277 |
| Molecular Formula | C26H41NO4 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 3-[(1S,5S)-3-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N,N-dimethylpropanamide |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H](CC)CC[C@@H]23)C[C@](O)(OCCC(=O)N(C)C)C[C@@H]1O |
| InChI | InChI=1S/C26H41NO4/c1-6-21-11-12-22-19(8-7-14-25(21,22)3)9-10-20-16-26(30,17-23(28)18(20)2)31-15-13-24(29)27(4)5/h9-10,21-23,28,30H,2,6-8,11-17H2,1,3-5H3/t21-,22-,23-,25+,26-/m0/s1 |
| InChIKey | NUMZZDNGULCUMX-XCEQJGIUSA-N |
| XLogP | 4.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|