C29H48O3S — CID 54221282
trans-(1S,3S)-5-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-(4-ethyl-4-hydroxyhexyl)sulfanyl-4-methylidenecyclohexane-1,3-diol (PubChem CID 54221282) has the molecular formula C29H48O3S and a molecular weight of 476.77 g/mol. Its IUPAC name is trans-(1S,3S)-5-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-(4-ethyl-4-hydroxyhexyl)sulfanyl-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1S,3S)-5-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-(4-ethyl-4-hydroxyhexyl)sulfanyl-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 54221282 |
| Molecular Formula | C29H48O3S |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | trans-(1S,3S)-5-[2-[(1S,3aS,7aR)-1-ethyl-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-(4-ethyl-4-hydroxyhexyl)sulfanyl-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H](CC)CC[C@@H]23)C[C@](O)(SCCCC(O)(CC)CC)C[C@@H]1O |
| InChI | InChI=1S/C29H48O3S/c1-6-24-14-15-25-22(11-9-16-27(24,25)5)12-13-23-19-29(32,20-26(30)21(23)4)33-18-10-17-28(31,7-2)8-3/h12-13,24-26,30-32H,4,6-11,14-20H2,1-3,5H3/t24-,25-,26-,27+,29-/m0/s1 |
| InChIKey | QCTQNGHQHVMKEU-AFBVCZJXSA-N |
| XLogP | 6.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|