C29H44O4S — CID 91545534
tert-butyl 4-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylbutanoate (PubChem CID 91545534) has the molecular formula C29H44O4S and a molecular weight of 488.73 g/mol. Its IUPAC name is tert-butyl 4-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylbutanoate.
| Compound Name | tert-butyl 4-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 91545534 |
| Molecular Formula | C29H44O4S |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | tert-butyl 4-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylbutanoate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(SCCCC(=O)OC(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C29H44O4S/c1-7-23-14-15-24-21(10-8-16-28(23,24)6)12-13-22-18-29(32,19-25(30)20(22)2)34-17-9-11-26(31)33-27(3,4)5/h12-14,24-25,30,32H,2,7-11,15-19H2,1,3-6H3/t24-,25-,28+,29-/m0/s1 |
| InChIKey | STLLOVQEYJSTGR-XHZCKAMJSA-N |
| XLogP | 6.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|