C30H46O5 — CID 91083764
2-methylhexan-2-yl 2-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate (PubChem CID 91083764) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is 2-methylhexan-2-yl 2-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate.
| Compound Name | 2-methylhexan-2-yl 2-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 91083764 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 2-methylhexan-2-yl 2-[(1S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(OCC(=O)OC(C)(C)CCCC)CC1O |
| InChI | InChI=1S/C30H46O5/c1-7-9-16-28(4,5)35-27(32)20-34-30(33)18-23(21(3)26(31)19-30)13-12-22-11-10-17-29(6)24(8-2)14-15-25(22)29/h12-14,25-26,31,33H,3,7-11,15-20H2,1-2,4-6H3/t25-,26?,29+,30-/m0/s1 |
| InChIKey | ULIOOOAWDNLDPF-PZHXIBQCSA-N |
| XLogP | 6.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|