C33H46O5 — CID 90893897
2-adamantyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate (PubChem CID 90893897) has the molecular formula C33H46O5 and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-adamantyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate.
| Compound Name | 2-adamantyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 90893897 |
| Molecular Formula | C33H46O5 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 2-adamantyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(OCC(=O)OC2C3CC4CC(C3)CC2C4)C[C@@H]1O |
| InChI | InChI=1S/C33H46O5/c1-4-27-9-10-28-23(6-5-11-32(27,28)3)7-8-24-17-33(36,18-29(34)20(24)2)37-19-30(35)38-31-25-13-21-12-22(15-25)16-26(31)14-21/h7-9,21-22,25-26,28-29,31,34,36H,2,4-6,10-19H2,1,3H3/t21?,22?,25?,26?,28-,29-,31?,32+,33-/m0/s1 |
| InChIKey | GSDFEFZYYWUEHR-UVWDTNQASA-N |
| XLogP | 6.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|