C27H40O4S — CID 91110916
tert-butyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylacetate (PubChem CID 91110916) has the molecular formula C27H40O4S and a molecular weight of 460.68 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 91110916 |
| Molecular Formula | C27H40O4S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | tert-butyl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]sulfanylacetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(SCC(=O)OC(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C27H40O4S/c1-7-21-12-13-22-19(9-8-14-26(21,22)6)10-11-20-15-27(30,16-23(28)18(20)2)32-17-24(29)31-25(3,4)5/h10-12,22-23,28,30H,2,7-9,13-17H2,1,3-6H3/t22-,23-,26+,27-/m0/s1 |
| InChIKey | QXRJJJSISOUEQG-IDJLGEMNSA-N |
| XLogP | 5.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|