C31H48O5 — CID 90708047
4-methylheptan-4-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate (PubChem CID 90708047) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is 4-methylheptan-4-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate.
| Compound Name | 4-methylheptan-4-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 90708047 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 4-methylheptan-4-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(OCC(=O)OC(C)(CCC)CCC)C[C@@H]1O |
| InChI | InChI=1S/C31H48O5/c1-7-16-29(5,17-8-2)36-28(33)21-35-31(34)19-24(22(4)27(32)20-31)13-12-23-11-10-18-30(6)25(9-3)14-15-26(23)30/h12-14,26-27,32,34H,4,7-11,15-21H2,1-3,5-6H3/t26-,27-,30+,31-/m0/s1 |
| InChIKey | IKLNWGZQGBRVGL-FOHQDORMSA-N |
| XLogP | 6.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|