C29H45NO4 — CID 91466507
N-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-(2-ethylbutyl)acetamide (PubChem CID 91466507) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is N-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-(2-ethylbutyl)acetamide.
| Compound Name | N-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-(2-ethylbutyl)acetamide |
|---|---|
| PubChem CID | 91466507 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | N-[(5S)-3-[2-[(7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxy-N-(2-ethylbutyl)acetamide |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CCC23)CC(O)(ON(CC(CC)CC)C(C)=O)C[C@@H]1O |
| InChI | InChI=1S/C29H45NO4/c1-7-22(8-2)19-30(21(5)31)34-29(33)17-24(20(4)27(32)18-29)13-12-23-11-10-16-28(6)25(9-3)14-15-26(23)28/h12-14,22,26-27,32-33H,4,7-11,15-19H2,1-3,5-6H3/t26?,27-,28+,29?/m0/s1 |
| InChIKey | OVYXUYXSJOVGTA-KSDCQUHYSA-N |
| XLogP | 6.00 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|