C32H50O5 — CID 91103126
2,2,4,4-tetramethylpentan-3-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate (PubChem CID 91103126) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentan-3-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate.
| Compound Name | 2,2,4,4-tetramethylpentan-3-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 91103126 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2,2,4,4-tetramethylpentan-3-yl 2-[(1S,5S)-3-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1,5-dihydroxy-4-methylidenecyclohexyl]oxyacetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(CC)=CC[C@@H]23)C[C@](O)(OCC(=O)OC(C(C)(C)C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C32H50O5/c1-10-24-15-16-25-22(12-11-17-31(24,25)9)13-14-23-18-32(35,19-26(33)21(23)2)36-20-27(34)37-28(29(3,4)5)30(6,7)8/h13-15,25-26,28,33,35H,2,10-12,16-20H2,1,3-9H3/t25-,26-,31+,32-/m0/s1 |
| InChIKey | ILWQZPDPHFEVIO-RTXLYREFSA-N |
| XLogP | 6.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|