C19H28O3 — CID 101072592
2-[(2R,4aR,8aS,10aR)-2,4a,8a-trimethyl-8-oxo-1,3,4,6,7,9,10,10a-octahydrophenanthren-2-yl]acetic acid (PubChem CID 101072592) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(2R,4aR,8aS,10aR)-2,4a,8a-trimethyl-8-oxo-1,3,4,6,7,9,10,10a-octahydrophenanthren-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aR,8aS,10aR)-2,4a,8a-trimethyl-8-oxo-1,3,4,6,7,9,10,10a-octahydrophenanthren-2-yl]acetic acid |
|---|---|
| PubChem CID | 101072592 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-[(2R,4aR,8aS,10aR)-2,4a,8a-trimethyl-8-oxo-1,3,4,6,7,9,10,10a-octahydrophenanthren-2-yl]acetic acid |
| SMILES | C[C@@]1(CC(=O)O)CC[C@@]2(C)C3=CCCC(=O)[C@@]3(C)CC[C@@H]2C1 |
| InChI | InChI=1S/C19H28O3/c1-17(12-16(21)22)9-10-18(2)13(11-17)7-8-19(3)14(18)5-4-6-15(19)20/h5,13H,4,6-12H2,1-3H3,(H,21,22)/t13-,17-,18-,19+/m1/s1 |
| InChIKey | PQXRZNVHEWRKLJ-XEKGUZQTSA-N |
| XLogP | 4.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|