C20H28O3 — CID 70672709
[(1R)-4b,8,8,10a-tetramethyl-7-oxo-1,2,3,5,6,10-hexahydrophenanthren-1-yl] acetate (PubChem CID 70672709) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(1R)-4b,8,8,10a-tetramethyl-7-oxo-1,2,3,5,6,10-hexahydrophenanthren-1-yl] acetate.
| Compound Name | [(1R)-4b,8,8,10a-tetramethyl-7-oxo-1,2,3,5,6,10-hexahydrophenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 70672709 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [(1R)-4b,8,8,10a-tetramethyl-7-oxo-1,2,3,5,6,10-hexahydrophenanthren-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC=C2C3(C)CCC(=O)C(C)(C)C3=CCC21C |
| InChI | InChI=1S/C20H28O3/c1-13(21)23-17-8-6-7-15-19(4)12-10-16(22)18(2,3)14(19)9-11-20(15,17)5/h7,9,17H,6,8,10-12H2,1-5H3/t17-,19?,20?/m1/s1 |
| InChIKey | BLDHNZNHNMDBRT-QHGAOEGBSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|