C16H26O2 — CID 54470961
[(8aS)-5,5,6,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl] acetate (PubChem CID 54470961) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is [(8aS)-5,5,6,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [(8aS)-5,5,6,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 54470961 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [(8aS)-5,5,6,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)OC1CCC=C2C(C)(C)C(C)CC[C@@]21C |
| InChI | InChI=1S/C16H26O2/c1-11-9-10-16(5)13(15(11,3)4)7-6-8-14(16)18-12(2)17/h7,11,14H,6,8-10H2,1-5H3/t11?,14?,16-/m0/s1 |
| InChIKey | XIIDQFAKETWBEO-INORYPFCSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|