C14H18O3 — CID 15309697
(3'aS,4'S)-4',6',6'-trimethylspiro[1,3-dioxolane-2,7'-3a,4-dihydroindene]-5'-one (PubChem CID 15309697) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3'aS,4'S)-4',6',6'-trimethylspiro[1,3-dioxolane-2,7'-3a,4-dihydroindene]-5'-one.
| Compound Name | (3'aS,4'S)-4',6',6'-trimethylspiro[1,3-dioxolane-2,7'-3a,4-dihydroindene]-5'-one |
|---|---|
| PubChem CID | 15309697 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3'aS,4'S)-4',6',6'-trimethylspiro[1,3-dioxolane-2,7'-3a,4-dihydroindene]-5'-one |
| SMILES | C[C@@H]1C(=O)C(C)(C)C2(OCCO2)C2=CC=C[C@H]21 |
| InChI | InChI=1S/C14H18O3/c1-9-10-5-4-6-11(10)14(16-7-8-17-14)13(2,3)12(9)15/h4-6,9-10H,7-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | XXQUVBMGMJFGIZ-UWVGGRQHSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |