C6H11NO2 — CID 126990472
4-amino-2,2-dimethyloxolan-3-one (PubChem CID 126990472) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 4-amino-2,2-dimethyloxolan-3-one.
| Compound Name | 4-amino-2,2-dimethyloxolan-3-one |
|---|---|
| PubChem CID | 126990472 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 4-amino-2,2-dimethyloxolan-3-one |
| SMILES | CC1(C)OCC(N)C1=O |
| InChI | InChI=1S/C6H11NO2/c1-6(2)5(8)4(7)3-9-6/h4H,3,7H2,1-2H3 |
| InChIKey | XGSFMNXKQMBMFG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |