C10H16O2 — CID 131123212
4-(cyclopropylmethyl)-2,2-dimethyloxolan-3-one (PubChem CID 131123212) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-2,2-dimethyloxolan-3-one.
| Compound Name | 4-(cyclopropylmethyl)-2,2-dimethyloxolan-3-one |
|---|---|
| PubChem CID | 131123212 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4-(cyclopropylmethyl)-2,2-dimethyloxolan-3-one |
| SMILES | CC1(C)OCC(CC2CC2)C1=O |
| InChI | InChI=1S/C10H16O2/c1-10(2)9(11)8(6-12-10)5-7-3-4-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | IMVGGSTWTYZMEU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |