C8H12F2O2 — CID 130706345
4-(2,2-difluoroethyl)-2,2-dimethyloxolan-3-one (PubChem CID 130706345) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-2,2-dimethyloxolan-3-one.
| Compound Name | 4-(2,2-difluoroethyl)-2,2-dimethyloxolan-3-one |
|---|---|
| PubChem CID | 130706345 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 4-(2,2-difluoroethyl)-2,2-dimethyloxolan-3-one |
| SMILES | CC1(C)OCC(CC(F)F)C1=O |
| InChI | InChI=1S/C8H12F2O2/c1-8(2)7(11)5(4-12-8)3-6(9)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | WERQOEZHCYWQBT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |