About 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one
4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one (PubChem CID 130825895) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one.
Molecular Properties
| Compound Name | 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one |
| PubChem CID | 130825895 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one |
| SMILES | CC(CC1COC(C)(C)C1=O)C1CCC1 |
| InChI | InChI=1S/C13H22O2/c1-9(10-5-4-6-10)7-11-8-15-13(2,3)12(11)14/h9-11H,4-8H2,1-3H3 |
| InChIKey | GLBMMSZHYCHJHZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one?
The IUPAC name of 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one (CID 130825895) is 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one.
What is the SMILES notation for 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one?
The canonical SMILES for 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one is CC(CC1COC(C)(C)C1=O)C1CCC1.
What is the InChIKey of 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one?
The InChIKey is GLBMMSZHYCHJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-9(10-5-4-6-10)7-11-8-15-13(2,3)12(11)14/h9-11H,4-8H2,1-3H3.
What are the key properties of 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one?
4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one has a molecular weight of 210.32 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclobutylpropyl)-2,2-dimethyloxolan-3-one is sourced from PubChem (CID 130825895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).