C8H13NO2 — CID 163437517
3-amino-1,5-dimethyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 163437517) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | 3-amino-1,5-dimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 163437517 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3-amino-1,5-dimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | CC1CC(N)C(=O)C2(C)OC12 |
| InChI | InChI=1S/C8H13NO2/c1-4-3-5(9)6(10)8(2)7(4)11-8/h4-5,7H,3,9H2,1-2H3 |
| InChIKey | AVSXHZZSXKTUBM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|