C9H12O3 — CID 102096201
(1R,2S,6R)-1,4-dimethylspiro[7-oxabicyclo[4.1.0]heptane-2,2'-oxirane]-3-one (PubChem CID 102096201) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (1R,2S,6R)-1,4-dimethylspiro[7-oxabicyclo[4.1.0]heptane-2,2'-oxirane]-3-one.
| Compound Name | (1R,2S,6R)-1,4-dimethylspiro[7-oxabicyclo[4.1.0]heptane-2,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 102096201 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (1R,2S,6R)-1,4-dimethylspiro[7-oxabicyclo[4.1.0]heptane-2,2'-oxirane]-3-one |
| SMILES | CC1C[C@H]2O[C@@]2(C)[C@@]2(CO2)C1=O |
| InChI | InChI=1S/C9H12O3/c1-5-3-6-8(2,12-6)9(4-11-9)7(5)10/h5-6H,3-4H2,1-2H3/t5?,6-,8-,9-/m1/s1 |
| InChIKey | CMTIQESNFBQEHO-IYDUGKLZSA-N |
| XLogP | 0.52 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|