C18H30O3 — CID 91152987
(3R,4S)-4-[(2R,3R)-2,3-dimethyloxiran-2-yl]-4,5,5,7,7,8,8-heptamethyl-1-oxaspiro[2.5]octan-6-one (PubChem CID 91152987) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (3R,4S)-4-[(2R,3R)-2,3-dimethyloxiran-2-yl]-4,5,5,7,7,8,8-heptamethyl-1-oxaspiro[2.5]octan-6-one.
| Compound Name | (3R,4S)-4-[(2R,3R)-2,3-dimethyloxiran-2-yl]-4,5,5,7,7,8,8-heptamethyl-1-oxaspiro[2.5]octan-6-one |
|---|---|
| PubChem CID | 91152987 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (3R,4S)-4-[(2R,3R)-2,3-dimethyloxiran-2-yl]-4,5,5,7,7,8,8-heptamethyl-1-oxaspiro[2.5]octan-6-one |
| SMILES | C[C@H]1O[C@]1(C)[C@@]1(C)C(C)(C)C(=O)C(C)(C)C(C)(C)[C@]12CO2 |
| InChI | InChI=1S/C18H30O3/c1-11-16(8,21-11)17(9)14(4,5)12(19)13(2,3)15(6,7)18(17)10-20-18/h11H,10H2,1-9H3/t11-,16+,17-,18-/m1/s1 |
| InChIKey | WFMYGFBJUSEBQZ-JZDMUPLMSA-N |
| XLogP | 3.60 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|