C12H20O4 — CID 69413279
1,4,4,5,5-pentamethyl-2,8,10-trioxabicyclo[5.2.1]decan-3-one (PubChem CID 69413279) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,4,4,5,5-pentamethyl-2,8,10-trioxabicyclo[5.2.1]decan-3-one.
| Compound Name | 1,4,4,5,5-pentamethyl-2,8,10-trioxabicyclo[5.2.1]decan-3-one |
|---|---|
| PubChem CID | 69413279 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1,4,4,5,5-pentamethyl-2,8,10-trioxabicyclo[5.2.1]decan-3-one |
| SMILES | CC12COC(CC(C)(C)C(C)(C)C(=O)O1)O2 |
| InChI | InChI=1S/C12H20O4/c1-10(2)6-8-14-7-12(5,15-8)16-9(13)11(10,3)4/h8H,6-7H2,1-5H3 |
| InChIKey | ZYRXQYIDALTFSP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |