C11H14O4 — CID 102096205
(1R,2R,4R,6S,7R)-2-methyl-7-propan-2-ylspiro[3,8-dioxatricyclo[5.1.0.02,4]octane-6,2'-oxirane]-5-one (PubChem CID 102096205) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1R,2R,4R,6S,7R)-2-methyl-7-propan-2-ylspiro[3,8-dioxatricyclo[5.1.0.02,4]octane-6,2'-oxirane]-5-one.
| Compound Name | (1R,2R,4R,6S,7R)-2-methyl-7-propan-2-ylspiro[3,8-dioxatricyclo[5.1.0.02,4]octane-6,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 102096205 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1R,2R,4R,6S,7R)-2-methyl-7-propan-2-ylspiro[3,8-dioxatricyclo[5.1.0.02,4]octane-6,2'-oxirane]-5-one |
| SMILES | CC(C)[C@@]12O[C@@H]1[C@@]1(C)O[C@H]1C(=O)[C@]21CO1 |
| InChI | InChI=1S/C11H14O4/c1-5(2)11-8(15-11)9(3)7(14-9)6(12)10(11)4-13-10/h5,7-8H,4H2,1-3H3/t7-,8+,9-,10+,11+/m0/s1 |
| InChIKey | BEIFXQALNWYESA-OGBGREFGSA-N |
| XLogP | 0.29 |
| TPSA | 54.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|