C10H12O2 — CID 163567910
8a-methyl-3,4a-dihydro-2H-chromen-4-one (PubChem CID 163567910) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 8a-methyl-3,4a-dihydro-2H-chromen-4-one.
| Compound Name | 8a-methyl-3,4a-dihydro-2H-chromen-4-one |
|---|---|
| PubChem CID | 163567910 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 8a-methyl-3,4a-dihydro-2H-chromen-4-one |
| SMILES | CC12C=CC=CC1C(=O)CCO2 |
| InChI | InChI=1S/C10H12O2/c1-10-6-3-2-4-8(10)9(11)5-7-12-10/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | FWUJXTODKNFSCY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |